1369 lines
38 KiB
C++
1369 lines
38 KiB
C++
/**
|
|
* @file llsys.cpp
|
|
* @brief Implementation of the basic system query functions.
|
|
*
|
|
* $LicenseInfo:firstyear=2002&license=viewerlgpl$
|
|
* Second Life Viewer Source Code
|
|
* Copyright (C) 2010, Linden Research, Inc.
|
|
*
|
|
* This library is free software; you can redistribute it and/or
|
|
* modify it under the terms of the GNU Lesser General Public
|
|
* License as published by the Free Software Foundation;
|
|
* version 2.1 of the License only.
|
|
*
|
|
* This library is distributed in the hope that it will be useful,
|
|
* but WITHOUT ANY WARRANTY; without even the implied warranty of
|
|
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
|
|
* Lesser General Public License for more details.
|
|
*
|
|
* You should have received a copy of the GNU Lesser General Public
|
|
* License along with this library; if not, write to the Free Software
|
|
* Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA
|
|
*
|
|
* Linden Research, Inc., 945 Battery Street, San Francisco, CA 94111 USA
|
|
* $/LicenseInfo$
|
|
*/
|
|
|
|
#if LL_WINDOWS
|
|
#pragma warning (disable : 4355) // 'this' used in initializer list: yes, intentionally
|
|
#endif
|
|
|
|
#include "linden_common.h"
|
|
|
|
#include "llsys.h"
|
|
|
|
#include <iostream>
|
|
#ifdef LL_USESYSTEMLIBS
|
|
# include <zlib.h>
|
|
#else
|
|
# include "zlib/zlib.h"
|
|
#endif
|
|
|
|
#include "llprocessor.h"
|
|
#include "llerrorcontrol.h"
|
|
#include "llevents.h"
|
|
#include "llformat.h"
|
|
#include "llregex.h"
|
|
#include "lltimer.h"
|
|
#include "llsdserialize.h"
|
|
#include "llsdutil.h"
|
|
#include <boost/bind.hpp>
|
|
#include <boost/circular_buffer.hpp>
|
|
#include <boost/foreach.hpp>
|
|
#include <boost/lexical_cast.hpp>
|
|
#include <boost/range.hpp>
|
|
#include <boost/utility/enable_if.hpp>
|
|
#include <boost/type_traits/is_integral.hpp>
|
|
#include <boost/type_traits/is_float.hpp>
|
|
#include "llfasttimer.h"
|
|
|
|
using namespace llsd;
|
|
|
|
#if LL_WINDOWS
|
|
# include "llwin32headerslean.h"
|
|
# include <psapi.h> // GetPerformanceInfo() et al.
|
|
# include <VersionHelpers.h>
|
|
#elif LL_DARWIN
|
|
# include <errno.h>
|
|
# include <sys/sysctl.h>
|
|
# include <sys/utsname.h>
|
|
# include <stdint.h>
|
|
# include <CoreServices/CoreServices.h>
|
|
# include <stdexcept>
|
|
# include <mach/host_info.h>
|
|
# include <mach/mach_host.h>
|
|
# include <mach/task.h>
|
|
# include <mach/task_info.h>
|
|
|
|
// disable warnings about Gestalt calls being deprecated
|
|
// until Apple get's on the ball and provides an alternative
|
|
//
|
|
#pragma GCC diagnostic ignored "-Wdeprecated-declarations"
|
|
|
|
#elif LL_LINUX
|
|
# include <errno.h>
|
|
# include <sys/utsname.h>
|
|
# include <unistd.h>
|
|
# include <sys/sysinfo.h>
|
|
# include <stdexcept>
|
|
const char MEMINFO_FILE[] = "/proc/meminfo";
|
|
# include <gnu/libc-version.h>
|
|
#endif
|
|
|
|
LLCPUInfo gSysCPU;
|
|
|
|
// Don't log memory info any more often than this. It also serves as our
|
|
// framerate sample size.
|
|
static const F32 MEM_INFO_THROTTLE = 20;
|
|
// Sliding window of samples. We intentionally limit the length of time we
|
|
// remember "the slowest" framerate because framerate is very slow at login.
|
|
// If we only triggered FrameWatcher logging when the session framerate
|
|
// dropped below the login framerate, we'd have very little additional data.
|
|
static const F32 MEM_INFO_WINDOW = 10*60;
|
|
|
|
LLOSInfo::LLOSInfo() :
|
|
mMajorVer(0), mMinorVer(0), mBuild(0), mOSVersionString("")
|
|
{
|
|
|
|
#if LL_WINDOWS
|
|
|
|
if (IsWindows10OrGreater())
|
|
{
|
|
mMajorVer = 10;
|
|
mMinorVer = 0;
|
|
if (IsWindowsServer())
|
|
{
|
|
mOSStringSimple = "Windows Server ";
|
|
}
|
|
else
|
|
{
|
|
mOSStringSimple = "Microsoft Windows 10 ";
|
|
}
|
|
}
|
|
else if (IsWindows8Point1OrGreater())
|
|
{
|
|
mMajorVer = 6;
|
|
mMinorVer = 3;
|
|
if (IsWindowsServer())
|
|
{
|
|
mOSStringSimple = "Windows Server 2012 R2 ";
|
|
}
|
|
else
|
|
{
|
|
mOSStringSimple = "Microsoft Windows 8.1 ";
|
|
}
|
|
}
|
|
else if (IsWindows8OrGreater())
|
|
{
|
|
mMajorVer = 6;
|
|
mMinorVer = 2;
|
|
if (IsWindowsServer())
|
|
{
|
|
mOSStringSimple = "Windows Server 2012 ";
|
|
}
|
|
else
|
|
{
|
|
mOSStringSimple = "Microsoft Windows 8 ";
|
|
}
|
|
}
|
|
else if (IsWindows7SP1OrGreater())
|
|
{
|
|
mMajorVer = 6;
|
|
mMinorVer = 1;
|
|
if (IsWindowsServer())
|
|
{
|
|
mOSStringSimple = "Windows Server 2008 R2 SP1 ";
|
|
}
|
|
else
|
|
{
|
|
mOSStringSimple = "Microsoft Windows 7 SP1 ";
|
|
}
|
|
}
|
|
else if (IsWindows7OrGreater())
|
|
{
|
|
mMajorVer = 6;
|
|
mMinorVer = 1;
|
|
if (IsWindowsServer())
|
|
{
|
|
mOSStringSimple = "Windows Server 2008 R2 ";
|
|
}
|
|
else
|
|
{
|
|
mOSStringSimple = "Microsoft Windows 7 ";
|
|
}
|
|
}
|
|
else if (IsWindowsVistaSP2OrGreater())
|
|
{
|
|
mMajorVer = 6;
|
|
mMinorVer = 0;
|
|
if (IsWindowsServer())
|
|
{
|
|
mOSStringSimple = "Windows Server 2008 SP2 ";
|
|
}
|
|
else
|
|
{
|
|
mOSStringSimple = "Microsoft Windows Vista SP2 ";
|
|
}
|
|
}
|
|
else
|
|
{
|
|
mOSStringSimple = "Unsupported Windows version ";
|
|
}
|
|
|
|
///get native system info if available..
|
|
typedef void (WINAPI *PGNSI)(LPSYSTEM_INFO); ///function pointer for loading GetNativeSystemInfo
|
|
SYSTEM_INFO si; //System Info object file contains architecture info
|
|
PGNSI pGNSI; //pointer object
|
|
ZeroMemory(&si, sizeof(SYSTEM_INFO)); //zero out the memory in information
|
|
pGNSI = (PGNSI)GetProcAddress(GetModuleHandle(TEXT("kernel32.dll")), "GetNativeSystemInfo"); //load kernel32 get function
|
|
if (NULL != pGNSI) //check if it has failed
|
|
pGNSI(&si); //success
|
|
else
|
|
GetSystemInfo(&si); //if it fails get regular system info
|
|
//(Warning: If GetSystemInfo it may result in incorrect information in a WOW64 machine, if the kernel fails to load)
|
|
|
|
// Try calling GetVersionEx using the OSVERSIONINFOEX structure.
|
|
OSVERSIONINFOEX osvi;
|
|
ZeroMemory(&osvi, sizeof(OSVERSIONINFOEX));
|
|
osvi.dwOSVersionInfoSize = sizeof(OSVERSIONINFOEX);
|
|
if (GetVersionEx((OSVERSIONINFO *)&osvi))
|
|
{
|
|
mBuild = osvi.dwBuildNumber & 0xffff;
|
|
}
|
|
else
|
|
{
|
|
// If OSVERSIONINFOEX doesn't work, try OSVERSIONINFO.
|
|
osvi.dwOSVersionInfoSize = sizeof(OSVERSIONINFO);
|
|
if (GetVersionEx((OSVERSIONINFO *)&osvi))
|
|
{
|
|
mBuild = osvi.dwBuildNumber & 0xffff;
|
|
}
|
|
}
|
|
|
|
S32 ubr = 0; // Windows 10 Update Build Revision, can be retrieved from a registry
|
|
if (mMajorVer == 10)
|
|
{
|
|
DWORD cbData(sizeof(DWORD));
|
|
DWORD data(0);
|
|
HKEY key;
|
|
BOOL ret_code = RegOpenKeyExW(HKEY_LOCAL_MACHINE, TEXT("SOFTWARE\\Microsoft\\Windows NT\\CurrentVersion"), 0, KEY_READ, &key);
|
|
if (ERROR_SUCCESS == ret_code)
|
|
{
|
|
ret_code = RegQueryValueExW(key, L"UBR", 0, NULL, reinterpret_cast<LPBYTE>(&data), &cbData);
|
|
if (ERROR_SUCCESS == ret_code)
|
|
{
|
|
ubr = data;
|
|
}
|
|
}
|
|
|
|
if (mBuild >= 22000)
|
|
{
|
|
// At release Windows 11 version was 10.0.22000.194
|
|
// Windows 10 version was 10.0.19043.1266
|
|
// There is no warranty that Win10 build won't increase,
|
|
// so until better solution is found or Microsoft updates
|
|
// SDK with IsWindows11OrGreater(), indicate "10/11"
|
|
//
|
|
// Current alternatives:
|
|
// Query WMI's Win32_OperatingSystem for OS string. Slow
|
|
// and likely to return 'compatibility' string.
|
|
// Check presence of dlls/libs or may be their version.
|
|
// <FS:Ansariel> Windows 11 detection
|
|
//mOSStringSimple = "Microsoft Windows 10/11 ";
|
|
mMajorVer = 11;
|
|
LLStringUtil::replaceString(mOSStringSimple, "10", "11");
|
|
// </FS:Ansariel>
|
|
}
|
|
}
|
|
|
|
//msdn microsoft finds 32 bit and 64 bit flavors this way..
|
|
//http://msdn.microsoft.com/en-us/library/ms724429(VS.85).aspx (example code that contains quite a few more flavors
|
|
//of windows than this code does (in case it is needed for the future)
|
|
if (si.wProcessorArchitecture == PROCESSOR_ARCHITECTURE_AMD64) //check for 64 bit
|
|
{
|
|
mOSStringSimple += "64-bit ";
|
|
}
|
|
else if (si.wProcessorArchitecture == PROCESSOR_ARCHITECTURE_INTEL)
|
|
{
|
|
mOSStringSimple += "32-bit ";
|
|
}
|
|
|
|
mOSString = mOSStringSimple;
|
|
if (mBuild > 0)
|
|
{
|
|
mOSString += llformat("(Build %d", mBuild);
|
|
if (ubr > 0)
|
|
{
|
|
mOSString += llformat(".%d", ubr);
|
|
}
|
|
mOSString += ")";
|
|
}
|
|
|
|
LLStringUtil::trim(mOSStringSimple);
|
|
LLStringUtil::trim(mOSString);
|
|
|
|
#elif LL_DARWIN
|
|
|
|
// Initialize mOSStringSimple to something like:
|
|
// "Mac OS X 10.6.7"
|
|
{
|
|
const char * DARWIN_PRODUCT_NAME = "Mac OS X";
|
|
|
|
SInt32 major_version, minor_version, bugfix_version;
|
|
OSErr r1 = Gestalt(gestaltSystemVersionMajor, &major_version);
|
|
OSErr r2 = Gestalt(gestaltSystemVersionMinor, &minor_version);
|
|
OSErr r3 = Gestalt(gestaltSystemVersionBugFix, &bugfix_version);
|
|
|
|
if((r1 == noErr) && (r2 == noErr) && (r3 == noErr))
|
|
{
|
|
mMajorVer = major_version;
|
|
mMinorVer = minor_version;
|
|
mBuild = bugfix_version;
|
|
|
|
std::stringstream os_version_string;
|
|
os_version_string << DARWIN_PRODUCT_NAME << " " << mMajorVer << "." << mMinorVer << "." << mBuild;
|
|
|
|
// Put it in the OS string we are compiling
|
|
mOSStringSimple.append(os_version_string.str());
|
|
}
|
|
else
|
|
{
|
|
mOSStringSimple.append("Unable to collect OS info");
|
|
}
|
|
}
|
|
|
|
// Initialize mOSString to something like:
|
|
// "Mac OS X 10.6.7 Darwin Kernel Version 10.7.0: Sat Jan 29 15:17:16 PST 2011; root:xnu-1504.9.37~1/RELEASE_I386 i386"
|
|
struct utsname un;
|
|
if(uname(&un) != -1)
|
|
{
|
|
mOSString = mOSStringSimple;
|
|
mOSString.append(" ");
|
|
mOSString.append(un.sysname);
|
|
mOSString.append(" ");
|
|
mOSString.append(un.release);
|
|
mOSString.append(" ");
|
|
mOSString.append(un.version);
|
|
mOSString.append(" ");
|
|
mOSString.append(un.machine);
|
|
}
|
|
else
|
|
{
|
|
mOSString = mOSStringSimple;
|
|
}
|
|
|
|
#elif LL_LINUX
|
|
|
|
struct utsname un;
|
|
if(uname(&un) != -1)
|
|
{
|
|
mOSStringSimple.append(un.sysname);
|
|
mOSStringSimple.append(" ");
|
|
mOSStringSimple.append(un.release);
|
|
|
|
mOSString = mOSStringSimple;
|
|
mOSString.append(" ");
|
|
mOSString.append(un.version);
|
|
mOSString.append(" ");
|
|
mOSString.append(un.machine);
|
|
|
|
// Simplify 'Simple'
|
|
std::string ostype = mOSStringSimple.substr(0, mOSStringSimple.find_first_of(" ", 0));
|
|
if (ostype == "Linux")
|
|
{
|
|
// Only care about major and minor Linux versions, truncate at second '.'
|
|
std::string::size_type idx1 = mOSStringSimple.find_first_of(".", 0);
|
|
std::string::size_type idx2 = (idx1 != std::string::npos) ? mOSStringSimple.find_first_of(".", idx1+1) : std::string::npos;
|
|
std::string simple = mOSStringSimple.substr(0, idx2);
|
|
if (simple.length() > 0)
|
|
mOSStringSimple = simple;
|
|
}
|
|
}
|
|
else
|
|
{
|
|
mOSStringSimple.append("Unable to collect OS info");
|
|
mOSString = mOSStringSimple;
|
|
}
|
|
|
|
const char OS_VERSION_MATCH_EXPRESSION[] = "([0-9]+)\\.([0-9]+)(\\.([0-9]+))?";
|
|
boost::regex os_version_parse(OS_VERSION_MATCH_EXPRESSION);
|
|
boost::smatch matched;
|
|
|
|
std::string glibc_version(gnu_get_libc_version());
|
|
if ( ll_regex_match(glibc_version, matched, os_version_parse) )
|
|
{
|
|
LL_INFOS("AppInit") << "Using glibc version '" << glibc_version << "' as OS version" << LL_ENDL;
|
|
|
|
std::string version_value;
|
|
|
|
if ( matched[1].matched ) // Major version
|
|
{
|
|
version_value.assign(matched[1].first, matched[1].second);
|
|
if (sscanf(version_value.c_str(), "%d", &mMajorVer) != 1)
|
|
{
|
|
LL_WARNS("AppInit") << "failed to parse major version '" << version_value << "' as a number" << LL_ENDL;
|
|
}
|
|
}
|
|
else
|
|
{
|
|
LL_ERRS("AppInit")
|
|
<< "OS version regex '" << OS_VERSION_MATCH_EXPRESSION
|
|
<< "' returned true, but major version [1] did not match"
|
|
<< LL_ENDL;
|
|
}
|
|
|
|
if ( matched[2].matched ) // Minor version
|
|
{
|
|
version_value.assign(matched[2].first, matched[2].second);
|
|
if (sscanf(version_value.c_str(), "%d", &mMinorVer) != 1)
|
|
{
|
|
LL_ERRS("AppInit") << "failed to parse minor version '" << version_value << "' as a number" << LL_ENDL;
|
|
}
|
|
}
|
|
else
|
|
{
|
|
LL_ERRS("AppInit")
|
|
<< "OS version regex '" << OS_VERSION_MATCH_EXPRESSION
|
|
<< "' returned true, but minor version [1] did not match"
|
|
<< LL_ENDL;
|
|
}
|
|
|
|
if ( matched[4].matched ) // Build version (optional) - note that [3] includes the '.'
|
|
{
|
|
version_value.assign(matched[4].first, matched[4].second);
|
|
if (sscanf(version_value.c_str(), "%d", &mBuild) != 1)
|
|
{
|
|
LL_ERRS("AppInit") << "failed to parse build version '" << version_value << "' as a number" << LL_ENDL;
|
|
}
|
|
}
|
|
else
|
|
{
|
|
LL_INFOS("AppInit")
|
|
<< "OS build version not provided; using zero"
|
|
<< LL_ENDL;
|
|
}
|
|
}
|
|
else
|
|
{
|
|
LL_WARNS("AppInit") << "glibc version '" << glibc_version << "' cannot be parsed to three numbers; using all zeros" << LL_ENDL;
|
|
}
|
|
|
|
#else
|
|
|
|
struct utsname un;
|
|
if(uname(&un) != -1)
|
|
{
|
|
mOSStringSimple.append(un.sysname);
|
|
mOSStringSimple.append(" ");
|
|
mOSStringSimple.append(un.release);
|
|
|
|
mOSString = mOSStringSimple;
|
|
mOSString.append(" ");
|
|
mOSString.append(un.version);
|
|
mOSString.append(" ");
|
|
mOSString.append(un.machine);
|
|
|
|
// Simplify 'Simple'
|
|
std::string ostype = mOSStringSimple.substr(0, mOSStringSimple.find_first_of(" ", 0));
|
|
if (ostype == "Linux")
|
|
{
|
|
// Only care about major and minor Linux versions, truncate at second '.'
|
|
std::string::size_type idx1 = mOSStringSimple.find_first_of(".", 0);
|
|
std::string::size_type idx2 = (idx1 != std::string::npos) ? mOSStringSimple.find_first_of(".", idx1+1) : std::string::npos;
|
|
std::string simple = mOSStringSimple.substr(0, idx2);
|
|
if (simple.length() > 0)
|
|
mOSStringSimple = simple;
|
|
}
|
|
}
|
|
else
|
|
{
|
|
mOSStringSimple.append("Unable to collect OS info");
|
|
mOSString = mOSStringSimple;
|
|
}
|
|
|
|
#endif
|
|
|
|
std::stringstream dotted_version_string;
|
|
dotted_version_string << mMajorVer << "." << mMinorVer << "." << mBuild;
|
|
mOSVersionString.append(dotted_version_string.str());
|
|
|
|
}
|
|
|
|
#ifndef LL_WINDOWS
|
|
// static
|
|
S32 LLOSInfo::getMaxOpenFiles()
|
|
{
|
|
const S32 OPEN_MAX_GUESS = 256;
|
|
|
|
#ifdef OPEN_MAX
|
|
static S32 open_max = OPEN_MAX;
|
|
#else
|
|
static S32 open_max = 0;
|
|
#endif
|
|
|
|
if (0 == open_max)
|
|
{
|
|
// First time through.
|
|
errno = 0;
|
|
if ( (open_max = sysconf(_SC_OPEN_MAX)) < 0)
|
|
{
|
|
if (0 == errno)
|
|
{
|
|
// Indeterminate.
|
|
open_max = OPEN_MAX_GUESS;
|
|
}
|
|
else
|
|
{
|
|
LL_ERRS() << "LLOSInfo::getMaxOpenFiles: sysconf error for _SC_OPEN_MAX" << LL_ENDL;
|
|
}
|
|
}
|
|
}
|
|
return open_max;
|
|
}
|
|
#endif
|
|
|
|
void LLOSInfo::stream(std::ostream& s) const
|
|
{
|
|
s << mOSString;
|
|
}
|
|
|
|
const std::string& LLOSInfo::getOSString() const
|
|
{
|
|
return mOSString;
|
|
}
|
|
|
|
const std::string& LLOSInfo::getOSStringSimple() const
|
|
{
|
|
return mOSStringSimple;
|
|
}
|
|
|
|
const std::string& LLOSInfo::getOSVersionString() const
|
|
{
|
|
return mOSVersionString;
|
|
}
|
|
|
|
//static
|
|
U32 LLOSInfo::getProcessVirtualSizeKB()
|
|
{
|
|
U32 virtual_size = 0;
|
|
#if LL_LINUX
|
|
# define STATUS_SIZE 2048
|
|
LLFILE* status_filep = LLFile::fopen("/proc/self/status", "rb");
|
|
if (status_filep)
|
|
{
|
|
S32 numRead = 0;
|
|
char buff[STATUS_SIZE]; /* Flawfinder: ignore */
|
|
|
|
size_t nbytes = fread(buff, 1, STATUS_SIZE-1, status_filep);
|
|
buff[nbytes] = '\0';
|
|
|
|
// All these guys return numbers in KB
|
|
char *memp = strstr(buff, "VmSize:");
|
|
if (memp)
|
|
{
|
|
numRead += sscanf(memp, "%*s %u", &virtual_size);
|
|
}
|
|
fclose(status_filep);
|
|
}
|
|
#endif
|
|
return virtual_size;
|
|
}
|
|
|
|
//static
|
|
U32 LLOSInfo::getProcessResidentSizeKB()
|
|
{
|
|
U32 resident_size = 0;
|
|
#if LL_LINUX
|
|
LLFILE* status_filep = LLFile::fopen("/proc/self/status", "rb");
|
|
if (status_filep != NULL)
|
|
{
|
|
S32 numRead = 0;
|
|
char buff[STATUS_SIZE]; /* Flawfinder: ignore */
|
|
|
|
size_t nbytes = fread(buff, 1, STATUS_SIZE-1, status_filep);
|
|
buff[nbytes] = '\0';
|
|
|
|
// All these guys return numbers in KB
|
|
char *memp = strstr(buff, "VmRSS:");
|
|
if (memp)
|
|
{
|
|
numRead += sscanf(memp, "%*s %u", &resident_size);
|
|
}
|
|
fclose(status_filep);
|
|
}
|
|
#endif
|
|
return resident_size;
|
|
}
|
|
|
|
LLCPUInfo::LLCPUInfo()
|
|
{
|
|
std::ostringstream out;
|
|
LLProcessorInfo proc;
|
|
// proc.WriteInfoTextFile("procInfo.txt");
|
|
mHasSSE = proc.hasSSE();
|
|
mHasSSE2 = proc.hasSSE2();
|
|
mHasAltivec = proc.hasAltivec();
|
|
mCPUMHz = (F64)proc.getCPUFrequency();
|
|
mFamily = proc.getCPUFamilyName();
|
|
mCPUString = "Unknown";
|
|
|
|
out << proc.getCPUBrandName();
|
|
if (200 < mCPUMHz && mCPUMHz < 10000) // *NOTE: cpu speed is often way wrong, do a sanity check
|
|
{
|
|
out << " (" << mCPUMHz << " MHz)";
|
|
}
|
|
mCPUString = out.str();
|
|
LLStringUtil::trim(mCPUString);
|
|
}
|
|
|
|
bool LLCPUInfo::hasAltivec() const
|
|
{
|
|
return mHasAltivec;
|
|
}
|
|
|
|
bool LLCPUInfo::hasSSE() const
|
|
{
|
|
return mHasSSE;
|
|
}
|
|
|
|
bool LLCPUInfo::hasSSE2() const
|
|
{
|
|
return mHasSSE2;
|
|
}
|
|
|
|
F64 LLCPUInfo::getMHz() const
|
|
{
|
|
return mCPUMHz;
|
|
}
|
|
|
|
std::string LLCPUInfo::getCPUString() const
|
|
{
|
|
return mCPUString;
|
|
}
|
|
|
|
void LLCPUInfo::stream(std::ostream& s) const
|
|
{
|
|
// gather machine information.
|
|
s << LLProcessorInfo().getCPUFeatureDescription();
|
|
|
|
// These are interesting as they reflect our internal view of the
|
|
// CPU's attributes regardless of platform
|
|
s << "->mHasSSE: " << (U32)mHasSSE << std::endl;
|
|
s << "->mHasSSE2: " << (U32)mHasSSE2 << std::endl;
|
|
s << "->mHasAltivec: " << (U32)mHasAltivec << std::endl;
|
|
s << "->mCPUMHz: " << mCPUMHz << std::endl;
|
|
s << "->mCPUString: " << mCPUString << std::endl;
|
|
}
|
|
|
|
// Helper class for LLMemoryInfo: accumulate stats in the form we store for
|
|
// LLMemoryInfo::getStatsMap().
|
|
class Stats
|
|
{
|
|
public:
|
|
Stats():
|
|
mStats(LLSD::emptyMap())
|
|
{}
|
|
|
|
// Store every integer type as LLSD::Integer.
|
|
template <class T>
|
|
void add(const LLSD::String& name, const T& value,
|
|
typename boost::enable_if<boost::is_integral<T> >::type* = 0)
|
|
{
|
|
mStats[name] = LLSD::Integer(value);
|
|
}
|
|
|
|
// Store every floating-point type as LLSD::Real.
|
|
template <class T>
|
|
void add(const LLSD::String& name, const T& value,
|
|
typename boost::enable_if<boost::is_float<T> >::type* = 0)
|
|
{
|
|
mStats[name] = LLSD::Real(value);
|
|
}
|
|
|
|
// Hope that LLSD::Date values are sufficiently unambiguous.
|
|
void add(const LLSD::String& name, const LLSD::Date& value)
|
|
{
|
|
mStats[name] = value;
|
|
}
|
|
|
|
LLSD get() const { return mStats; }
|
|
|
|
private:
|
|
LLSD mStats;
|
|
};
|
|
|
|
LLMemoryInfo::LLMemoryInfo()
|
|
{
|
|
refresh();
|
|
}
|
|
|
|
#if LL_WINDOWS
|
|
static U32Kilobytes LLMemoryAdjustKBResult(U32Kilobytes inKB)
|
|
{
|
|
// Moved this here from llfloaterabout.cpp
|
|
|
|
//! \bug
|
|
// For some reason, the reported amount of memory is always wrong.
|
|
// The original adjustment assumes it's always off by one meg, however
|
|
// errors of as much as 2520 KB have been observed in the value
|
|
// returned from the GetMemoryStatusEx function. Here we keep the
|
|
// original adjustment from llfoaterabout.cpp until this can be
|
|
// fixed somehow.
|
|
inKB += U32Megabytes(1);
|
|
|
|
return inKB;
|
|
}
|
|
#endif
|
|
|
|
#if LL_DARWIN
|
|
// static
|
|
U32Kilobytes LLMemoryInfo::getHardwareMemSize()
|
|
{
|
|
// This might work on Linux as well. Someone check...
|
|
uint64_t phys = 0;
|
|
int mib[2] = { CTL_HW, HW_MEMSIZE };
|
|
|
|
size_t len = sizeof(phys);
|
|
sysctl(mib, 2, &phys, &len, NULL, 0);
|
|
|
|
return U64Bytes(phys);
|
|
}
|
|
#endif
|
|
|
|
U32Kilobytes LLMemoryInfo::getPhysicalMemoryKB() const
|
|
{
|
|
#if LL_WINDOWS
|
|
return LLMemoryAdjustKBResult(U32Kilobytes(mStatsMap["Total Physical KB"].asInteger()));
|
|
|
|
#elif LL_DARWIN
|
|
return getHardwareMemSize();
|
|
|
|
#elif LL_LINUX
|
|
U64 phys = 0;
|
|
phys = (U64)(getpagesize()) * (U64)(get_phys_pages());
|
|
return U64Bytes(phys);
|
|
|
|
#else
|
|
return 0;
|
|
|
|
#endif
|
|
}
|
|
|
|
//static
|
|
void LLMemoryInfo::getAvailableMemoryKB(U32Kilobytes& avail_physical_mem_kb, U32Kilobytes& avail_virtual_mem_kb)
|
|
{
|
|
#if LL_WINDOWS
|
|
// Sigh, this shouldn't be a static method, then we wouldn't have to
|
|
// reload this data separately from refresh()
|
|
|
|
LLSD statsMap(loadStatsMap());
|
|
|
|
avail_physical_mem_kb = (U32Kilobytes)statsMap["Avail Physical KB"].asInteger();
|
|
avail_virtual_mem_kb = (U32Kilobytes)statsMap["Avail Virtual KB"].asInteger();
|
|
|
|
#elif LL_DARWIN
|
|
// mStatsMap is derived from vm_stat, look for (e.g.) "kb free":
|
|
// $ vm_stat
|
|
// Mach Virtual Memory Statistics: (page size of 4096 bytes)
|
|
// Pages free: 462078.
|
|
// Pages active: 142010.
|
|
// Pages inactive: 220007.
|
|
// Pages wired down: 159552.
|
|
// "Translation faults": 220825184.
|
|
// Pages copy-on-write: 2104153.
|
|
// Pages zero filled: 167034876.
|
|
// Pages reactivated: 65153.
|
|
// Pageins: 2097212.
|
|
// Pageouts: 41759.
|
|
// Object cache: 841598 hits of 7629869 lookups (11% hit rate)
|
|
avail_physical_mem_kb = (U32Kilobytes)-1 ;
|
|
avail_virtual_mem_kb = (U32Kilobytes)-1 ;
|
|
|
|
#elif LL_LINUX
|
|
// mStatsMap is derived from MEMINFO_FILE:
|
|
// $ cat /proc/meminfo
|
|
// MemTotal: 4108424 kB
|
|
// MemFree: 1244064 kB
|
|
// Buffers: 85164 kB
|
|
// Cached: 1990264 kB
|
|
// SwapCached: 0 kB
|
|
// Active: 1176648 kB
|
|
// Inactive: 1427532 kB
|
|
// Active(anon): 529152 kB
|
|
// Inactive(anon): 15924 kB
|
|
// Active(file): 647496 kB
|
|
// Inactive(file): 1411608 kB
|
|
// Unevictable: 16 kB
|
|
// Mlocked: 16 kB
|
|
// HighTotal: 3266316 kB
|
|
// HighFree: 721308 kB
|
|
// LowTotal: 842108 kB
|
|
// LowFree: 522756 kB
|
|
// SwapTotal: 6384632 kB
|
|
// SwapFree: 6384632 kB
|
|
// Dirty: 28 kB
|
|
// Writeback: 0 kB
|
|
// AnonPages: 528820 kB
|
|
// Mapped: 89472 kB
|
|
// Shmem: 16324 kB
|
|
// Slab: 159624 kB
|
|
// SReclaimable: 145168 kB
|
|
// SUnreclaim: 14456 kB
|
|
// KernelStack: 2560 kB
|
|
// PageTables: 5560 kB
|
|
// NFS_Unstable: 0 kB
|
|
// Bounce: 0 kB
|
|
// WritebackTmp: 0 kB
|
|
// CommitLimit: 8438844 kB
|
|
// Committed_AS: 1271596 kB
|
|
// VmallocTotal: 122880 kB
|
|
// VmallocUsed: 65252 kB
|
|
// VmallocChunk: 52356 kB
|
|
// HardwareCorrupted: 0 kB
|
|
// HugePages_Total: 0
|
|
// HugePages_Free: 0
|
|
// HugePages_Rsvd: 0
|
|
// HugePages_Surp: 0
|
|
// Hugepagesize: 2048 kB
|
|
// DirectMap4k: 434168 kB
|
|
// DirectMap2M: 477184 kB
|
|
// (could also run 'free', but easier to read a file than run a program)
|
|
avail_physical_mem_kb = (U32Kilobytes)-1 ;
|
|
avail_virtual_mem_kb = (U32Kilobytes)-1 ;
|
|
|
|
#else
|
|
//do not know how to collect available memory info for other systems.
|
|
//leave it blank here for now.
|
|
|
|
avail_physical_mem_kb = (U32Kilobytes)-1 ;
|
|
avail_virtual_mem_kb = (U32Kilobytes)-1 ;
|
|
#endif
|
|
}
|
|
|
|
void LLMemoryInfo::stream(std::ostream& s) const
|
|
{
|
|
// We want these memory stats to be easy to grep from the log, along with
|
|
// the timestamp. So preface each line with the timestamp and a
|
|
// distinctive marker. Without that, we'd have to search the log for the
|
|
// introducer line, then read subsequent lines, etc...
|
|
std::string pfx(LLError::utcTime() + " <mem> ");
|
|
|
|
// Max key length
|
|
size_t key_width(0);
|
|
BOOST_FOREACH(const MapEntry& pair, inMap(mStatsMap))
|
|
{
|
|
size_t len(pair.first.length());
|
|
if (len > key_width)
|
|
{
|
|
key_width = len;
|
|
}
|
|
}
|
|
|
|
// Now stream stats
|
|
BOOST_FOREACH(const MapEntry& pair, inMap(mStatsMap))
|
|
{
|
|
s << pfx << std::setw(key_width+1) << (pair.first + ':') << ' ';
|
|
LLSD value(pair.second);
|
|
if (value.isInteger())
|
|
s << std::setw(12) << value.asInteger();
|
|
else if (value.isReal())
|
|
s << std::fixed << std::setprecision(1) << value.asReal();
|
|
else if (value.isDate())
|
|
value.asDate().toStream(s);
|
|
else
|
|
s << value; // just use default LLSD formatting
|
|
s << std::endl;
|
|
}
|
|
}
|
|
|
|
LLSD LLMemoryInfo::getStatsMap() const
|
|
{
|
|
return mStatsMap;
|
|
}
|
|
|
|
LLMemoryInfo& LLMemoryInfo::refresh()
|
|
{
|
|
LL_PROFILE_ZONE_SCOPED
|
|
mStatsMap = loadStatsMap();
|
|
|
|
LL_DEBUGS("LLMemoryInfo") << "Populated mStatsMap:\n";
|
|
LLSDSerialize::toPrettyXML(mStatsMap, LL_CONT);
|
|
LL_ENDL;
|
|
|
|
return *this;
|
|
}
|
|
|
|
LLSD LLMemoryInfo::loadStatsMap()
|
|
{
|
|
LL_PROFILE_ZONE_SCOPED;
|
|
|
|
// This implementation is derived from stream() code (as of 2011-06-29).
|
|
Stats stats;
|
|
|
|
// associate timestamp for analysis over time
|
|
stats.add("timestamp", LLDate::now());
|
|
|
|
#if LL_WINDOWS
|
|
MEMORYSTATUSEX state;
|
|
state.dwLength = sizeof(state);
|
|
GlobalMemoryStatusEx(&state);
|
|
|
|
DWORDLONG div = 1024;
|
|
|
|
stats.add("Percent Memory use", state.dwMemoryLoad/div);
|
|
// <FS:Ansariel> Ugly, but prevent overflow
|
|
//stats.add("Total Physical KB", state.ullTotalPhys/div);
|
|
//stats.add("Avail Physical KB", state.ullAvailPhys/div);
|
|
//stats.add("Total page KB", state.ullTotalPageFile/div);
|
|
//stats.add("Avail page KB", state.ullAvailPageFile/div);
|
|
//stats.add("Total Virtual KB", state.ullTotalVirtual/div);
|
|
//stats.add("Avail Virtual KB", state.ullAvailVirtual/div);
|
|
stats.add("Total Physical KB", llclamp(state.ullTotalPhys/div, U64(0), U64(S32_MAX)));
|
|
stats.add("Avail Physical KB", llclamp(state.ullAvailPhys/div, U64(0), U64(S32_MAX)));
|
|
stats.add("Total page KB", llclamp(state.ullTotalPageFile/div, U64(0), U64(S32_MAX)));
|
|
stats.add("Avail page KB", llclamp(state.ullAvailPageFile/div, U64(0), U64(S32_MAX)));
|
|
stats.add("Total Virtual KB", llclamp(state.ullTotalVirtual/div, U64(0), U64(S32_MAX)));
|
|
stats.add("Avail Virtual KB", llclamp(state.ullAvailVirtual/div, U64(0), U64(S32_MAX)));
|
|
// </FS:Ansariel>
|
|
|
|
// SL-12122 - Call to GetPerformanceInfo() was removed here. Took
|
|
// on order of 10 ms, causing unacceptable frame time spike every
|
|
// second, and results were never used. If this is needed in the
|
|
// future, must find a way to avoid frame time impact (e.g. move
|
|
// to another thread, call much less often).
|
|
|
|
PROCESS_MEMORY_COUNTERS_EX pmem;
|
|
pmem.cb = sizeof(pmem);
|
|
// GetProcessMemoryInfo() is documented to accept either
|
|
// PROCESS_MEMORY_COUNTERS* or PROCESS_MEMORY_COUNTERS_EX*, presumably
|
|
// using the redundant size info to distinguish. But its prototype
|
|
// specifically accepts PROCESS_MEMORY_COUNTERS*, and since this is a
|
|
// classic-C API, PROCESS_MEMORY_COUNTERS_EX isn't a subclass. Cast the
|
|
// pointer.
|
|
GetProcessMemoryInfo(GetCurrentProcess(), PPROCESS_MEMORY_COUNTERS(&pmem), sizeof(pmem));
|
|
|
|
stats.add("Page Fault Count", pmem.PageFaultCount);
|
|
stats.add("PeakWorkingSetSize KB", pmem.PeakWorkingSetSize/div);
|
|
stats.add("WorkingSetSize KB", pmem.WorkingSetSize/div);
|
|
stats.add("QutaPeakPagedPoolUsage KB", pmem.QuotaPeakPagedPoolUsage/div);
|
|
stats.add("QuotaPagedPoolUsage KB", pmem.QuotaPagedPoolUsage/div);
|
|
stats.add("QuotaPeakNonPagedPoolUsage KB", pmem.QuotaPeakNonPagedPoolUsage/div);
|
|
stats.add("QuotaNonPagedPoolUsage KB", pmem.QuotaNonPagedPoolUsage/div);
|
|
stats.add("PagefileUsage KB", pmem.PagefileUsage/div);
|
|
stats.add("PeakPagefileUsage KB", pmem.PeakPagefileUsage/div);
|
|
stats.add("PrivateUsage KB", pmem.PrivateUsage/div);
|
|
|
|
#elif LL_DARWIN
|
|
|
|
const vm_size_t pagekb(vm_page_size / 1024);
|
|
|
|
//
|
|
// Collect the vm_stat's
|
|
//
|
|
|
|
{
|
|
vm_statistics64_data_t vmstat;
|
|
mach_msg_type_number_t vmstatCount = HOST_VM_INFO64_COUNT;
|
|
|
|
if (host_statistics64(mach_host_self(), HOST_VM_INFO64, (host_info64_t) &vmstat, &vmstatCount) != KERN_SUCCESS)
|
|
{
|
|
LL_WARNS("LLMemoryInfo") << "Unable to collect memory information" << LL_ENDL;
|
|
}
|
|
else
|
|
{
|
|
stats.add("Pages free KB", pagekb * vmstat.free_count);
|
|
stats.add("Pages active KB", pagekb * vmstat.active_count);
|
|
stats.add("Pages inactive KB", pagekb * vmstat.inactive_count);
|
|
stats.add("Pages wired KB", pagekb * vmstat.wire_count);
|
|
|
|
stats.add("Pages zero fill", vmstat.zero_fill_count);
|
|
stats.add("Page reactivations", vmstat.reactivations);
|
|
stats.add("Page-ins", vmstat.pageins);
|
|
stats.add("Page-outs", vmstat.pageouts);
|
|
|
|
stats.add("Faults", vmstat.faults);
|
|
stats.add("Faults copy-on-write", vmstat.cow_faults);
|
|
|
|
stats.add("Cache lookups", vmstat.lookups);
|
|
stats.add("Cache hits", vmstat.hits);
|
|
|
|
stats.add("Page purgeable count", vmstat.purgeable_count);
|
|
stats.add("Page purges", vmstat.purges);
|
|
|
|
stats.add("Page speculative reads", vmstat.speculative_count);
|
|
}
|
|
}
|
|
|
|
//
|
|
// Collect the misc task info
|
|
//
|
|
|
|
{
|
|
task_events_info_data_t taskinfo;
|
|
unsigned taskinfoSize = sizeof(taskinfo);
|
|
|
|
if (task_info(mach_task_self(), TASK_EVENTS_INFO, (task_info_t) &taskinfo, &taskinfoSize) != KERN_SUCCESS)
|
|
{
|
|
LL_WARNS("LLMemoryInfo") << "Unable to collect task information" << LL_ENDL;
|
|
}
|
|
else
|
|
{
|
|
stats.add("Task page-ins", taskinfo.pageins);
|
|
stats.add("Task copy-on-write faults", taskinfo.cow_faults);
|
|
stats.add("Task messages sent", taskinfo.messages_sent);
|
|
stats.add("Task messages received", taskinfo.messages_received);
|
|
stats.add("Task mach system call count", taskinfo.syscalls_mach);
|
|
stats.add("Task unix system call count", taskinfo.syscalls_unix);
|
|
stats.add("Task context switch count", taskinfo.csw);
|
|
}
|
|
}
|
|
|
|
//
|
|
// Collect the basic task info
|
|
//
|
|
|
|
{
|
|
mach_task_basic_info_data_t taskinfo;
|
|
mach_msg_type_number_t task_count = MACH_TASK_BASIC_INFO_COUNT;
|
|
if (task_info(mach_task_self(), MACH_TASK_BASIC_INFO, (task_info_t) &taskinfo, &task_count) != KERN_SUCCESS)
|
|
{
|
|
LL_WARNS("LLMemoryInfo") << "Unable to collect task information" << LL_ENDL;
|
|
}
|
|
else
|
|
{
|
|
stats.add("Basic virtual memory KB", taskinfo.virtual_size / 1024);
|
|
stats.add("Basic resident memory KB", taskinfo.resident_size / 1024);
|
|
stats.add("Basic max resident memory KB", taskinfo.resident_size_max / 1024);
|
|
stats.add("Basic new thread policy", taskinfo.policy);
|
|
stats.add("Basic suspend count", taskinfo.suspend_count);
|
|
}
|
|
}
|
|
|
|
#elif LL_LINUX
|
|
std::ifstream meminfo(MEMINFO_FILE);
|
|
if (meminfo.is_open())
|
|
{
|
|
// MemTotal: 4108424 kB
|
|
// MemFree: 1244064 kB
|
|
// Buffers: 85164 kB
|
|
// Cached: 1990264 kB
|
|
// SwapCached: 0 kB
|
|
// Active: 1176648 kB
|
|
// Inactive: 1427532 kB
|
|
// ...
|
|
// VmallocTotal: 122880 kB
|
|
// VmallocUsed: 65252 kB
|
|
// VmallocChunk: 52356 kB
|
|
// HardwareCorrupted: 0 kB
|
|
// HugePages_Total: 0
|
|
// HugePages_Free: 0
|
|
// HugePages_Rsvd: 0
|
|
// HugePages_Surp: 0
|
|
// Hugepagesize: 2048 kB
|
|
// DirectMap4k: 434168 kB
|
|
// DirectMap2M: 477184 kB
|
|
|
|
// Intentionally don't pass the boost::no_except flag. This
|
|
// boost::regex object is constructed with a string literal, so it
|
|
// should be valid every time. If it becomes invalid, we WANT an
|
|
// exception, hopefully even before the dev checks in.
|
|
boost::regex stat_rx("(.+): +([0-9]+)( kB)?");
|
|
boost::smatch matched;
|
|
|
|
std::string line;
|
|
while (std::getline(meminfo, line))
|
|
{
|
|
LL_DEBUGS("LLMemoryInfo") << line << LL_ENDL;
|
|
if (ll_regex_match(line, matched, stat_rx))
|
|
{
|
|
// e.g. "MemTotal: 4108424 kB"
|
|
LLSD::String key(matched[1].first, matched[1].second);
|
|
LLSD::String value_str(matched[2].first, matched[2].second);
|
|
LLSD::Integer value(0);
|
|
try
|
|
{
|
|
value = boost::lexical_cast<LLSD::Integer>(value_str);
|
|
}
|
|
catch (const boost::bad_lexical_cast&)
|
|
{
|
|
//<FS:TS> FIRE-10950: Deal with VM sizes too big to fit in 32 bits
|
|
//LL_WARNS("LLMemoryInfo") << "couldn't parse '" << value_str
|
|
// << "' in " << MEMINFO_FILE << " line: "
|
|
// << line << LL_ENDL;
|
|
//continue;
|
|
U64 bigvalue = 0;
|
|
try
|
|
{
|
|
bigvalue = boost::lexical_cast<U64>(value_str);
|
|
}
|
|
catch (const boost::bad_lexical_cast&)
|
|
{
|
|
LL_WARNS("LLMemoryInfo") << "couldn't parse '" << value_str
|
|
<< "' in " << MEMINFO_FILE << " line: "
|
|
<< line << LL_ENDL;
|
|
continue;
|
|
}
|
|
stats.add(key,bigvalue);
|
|
continue;
|
|
//</FS:TS> FIRE-10950
|
|
}
|
|
// Store this statistic.
|
|
stats.add(key, value);
|
|
}
|
|
else
|
|
{
|
|
LL_WARNS("LLMemoryInfo") << "unrecognized " << MEMINFO_FILE << " line: "
|
|
<< line << LL_ENDL;
|
|
}
|
|
}
|
|
}
|
|
else
|
|
{
|
|
LL_WARNS("LLMemoryInfo") << "Unable to collect memory information" << LL_ENDL;
|
|
}
|
|
|
|
#else
|
|
LL_WARNS("LLMemoryInfo") << "Unknown system; unable to collect memory information" << LL_ENDL;
|
|
|
|
#endif
|
|
|
|
return stats.get();
|
|
}
|
|
|
|
std::ostream& operator<<(std::ostream& s, const LLOSInfo& info)
|
|
{
|
|
info.stream(s);
|
|
return s;
|
|
}
|
|
|
|
std::ostream& operator<<(std::ostream& s, const LLCPUInfo& info)
|
|
{
|
|
info.stream(s);
|
|
return s;
|
|
}
|
|
|
|
std::ostream& operator<<(std::ostream& s, const LLMemoryInfo& info)
|
|
{
|
|
info.stream(s);
|
|
return s;
|
|
}
|
|
|
|
class FrameWatcher
|
|
{
|
|
public:
|
|
FrameWatcher():
|
|
// Hooking onto the "mainloop" event pump gets us one call per frame.
|
|
mConnection(LLEventPumps::instance()
|
|
.obtain("mainloop")
|
|
.listen("FrameWatcher", boost::bind(&FrameWatcher::tick, this, _1))),
|
|
// Initializing mSampleStart to an invalid timestamp alerts us to skip
|
|
// trying to compute framerate on the first call.
|
|
mSampleStart(-1),
|
|
// Initializing mSampleEnd to 0 ensures that we treat the first call
|
|
// as the completion of a sample window.
|
|
mSampleEnd(0),
|
|
mFrames(0),
|
|
// Both MEM_INFO_WINDOW and MEM_INFO_THROTTLE are in seconds. We need
|
|
// the number of integer MEM_INFO_THROTTLE sample slots that will fit
|
|
// in MEM_INFO_WINDOW. Round up.
|
|
mSamples(int((MEM_INFO_WINDOW / MEM_INFO_THROTTLE) + 0.7)),
|
|
// Initializing to F32_MAX means that the first real frame will become
|
|
// the slowest ever, which sounds like a good idea.
|
|
mSlowest(F32_MAX)
|
|
{}
|
|
|
|
bool tick(const LLSD&)
|
|
{
|
|
F32 timestamp(mTimer.getElapsedTimeF32());
|
|
|
|
// Count this frame in the interval just completed.
|
|
++mFrames;
|
|
|
|
// Have we finished a sample window yet?
|
|
if (timestamp < mSampleEnd)
|
|
{
|
|
// no, just keep waiting
|
|
return false;
|
|
}
|
|
|
|
// Set up for next sample window. Capture values for previous frame in
|
|
// local variables and reset data members.
|
|
U32 frames(mFrames);
|
|
F32 sampleStart(mSampleStart);
|
|
// No frames yet in next window
|
|
mFrames = 0;
|
|
// which starts right now
|
|
mSampleStart = timestamp;
|
|
// and ends MEM_INFO_THROTTLE seconds in the future
|
|
mSampleEnd = mSampleStart + MEM_INFO_THROTTLE;
|
|
|
|
// On the very first call, that's all we can do, no framerate
|
|
// computation is possible.
|
|
if (sampleStart < 0)
|
|
{
|
|
return false;
|
|
}
|
|
|
|
// How long did this actually take? As framerate slows, the duration
|
|
// of the frame we just finished could push us WELL beyond our desired
|
|
// sample window size.
|
|
F32 elapsed(timestamp - sampleStart);
|
|
F32 framerate(frames/elapsed);
|
|
|
|
// Remember previous slowest framerate because we're just about to
|
|
// update it.
|
|
F32 slowest(mSlowest);
|
|
// Remember previous number of samples.
|
|
boost::circular_buffer<F32>::size_type prevSize(mSamples.size());
|
|
|
|
// Capture new framerate in our samples buffer. Once the buffer is
|
|
// full (after MEM_INFO_WINDOW seconds), this will displace the oldest
|
|
// sample. ("So they all rolled over, and one fell out...")
|
|
mSamples.push_back(framerate);
|
|
|
|
// Calculate the new minimum framerate. I know of no way to update a
|
|
// rolling minimum without ever rescanning the buffer. But since there
|
|
// are only a few tens of items in this buffer, rescanning it is
|
|
// probably cheaper (and certainly easier to reason about) than
|
|
// attempting to optimize away some of the scans.
|
|
mSlowest = framerate; // pick an arbitrary entry to start
|
|
for (boost::circular_buffer<F32>::const_iterator si(mSamples.begin()), send(mSamples.end());
|
|
si != send; ++si)
|
|
{
|
|
if (*si < mSlowest)
|
|
{
|
|
mSlowest = *si;
|
|
}
|
|
}
|
|
|
|
// We're especially interested in memory as framerate drops. Only log
|
|
// when framerate drops below the slowest framerate we remember.
|
|
// (Should always be true for the end of the very first sample
|
|
// window.)
|
|
if (framerate >= slowest)
|
|
{
|
|
return false;
|
|
}
|
|
// Congratulations, we've hit a new low. :-P
|
|
|
|
LL_INFOS("FrameWatcher") << ' ';
|
|
if (! prevSize)
|
|
{
|
|
LL_CONT << "initial framerate ";
|
|
}
|
|
else
|
|
{
|
|
LL_CONT << "slowest framerate for last " << int(prevSize * MEM_INFO_THROTTLE)
|
|
<< " seconds ";
|
|
}
|
|
|
|
S32 precision = LL_CONT.precision();
|
|
|
|
LL_CONT << std::fixed << std::setprecision(1) << framerate << '\n'
|
|
<< LLMemoryInfo();
|
|
|
|
LL_CONT.precision(precision);
|
|
LL_CONT << LL_ENDL;
|
|
return false;
|
|
}
|
|
|
|
private:
|
|
// Storing the connection in an LLTempBoundListener ensures it will be
|
|
// disconnected when we're destroyed.
|
|
LLTempBoundListener mConnection;
|
|
// Track elapsed time
|
|
LLTimer mTimer;
|
|
// Some of what you see here is in fact redundant with functionality you
|
|
// can get from LLTimer. Unfortunately the LLTimer API is missing the
|
|
// feature we need: has at least the stated interval elapsed, and if so,
|
|
// exactly how long has passed? So we have to do it by hand, sigh.
|
|
// Time at start, end of sample window
|
|
F32 mSampleStart, mSampleEnd;
|
|
// Frames this sample window
|
|
U32 mFrames;
|
|
// Sliding window of framerate samples
|
|
boost::circular_buffer<F32> mSamples;
|
|
// Slowest framerate in mSamples
|
|
F32 mSlowest;
|
|
};
|
|
|
|
// Need an instance of FrameWatcher before it does any good
|
|
static FrameWatcher sFrameWatcher;
|
|
|
|
BOOL gunzip_file(const std::string& srcfile, const std::string& dstfile)
|
|
{
|
|
std::string tmpfile;
|
|
const S32 UNCOMPRESS_BUFFER_SIZE = 32768;
|
|
BOOL retval = FALSE;
|
|
gzFile src = NULL;
|
|
U8 buffer[UNCOMPRESS_BUFFER_SIZE];
|
|
LLFILE *dst = NULL;
|
|
S32 bytes = 0;
|
|
tmpfile = dstfile + ".t";
|
|
#ifdef LL_WINDOWS
|
|
llutf16string utf16filename = utf8str_to_utf16str(srcfile);
|
|
src = gzopen_w(utf16filename.c_str(), "rb");
|
|
#else
|
|
src = gzopen(srcfile.c_str(), "rb");
|
|
#endif
|
|
if (! src) goto err;
|
|
dst = LLFile::fopen(tmpfile, "wb"); /* Flawfinder: ignore */
|
|
if (! dst) goto err;
|
|
do
|
|
{
|
|
bytes = gzread(src, buffer, UNCOMPRESS_BUFFER_SIZE);
|
|
size_t nwrit = fwrite(buffer, sizeof(U8), bytes, dst);
|
|
if (nwrit < (size_t) bytes)
|
|
{
|
|
LL_WARNS() << "Short write on " << tmpfile << ": Wrote " << nwrit << " of " << bytes << " bytes." << LL_ENDL;
|
|
goto err;
|
|
}
|
|
} while(gzeof(src) == 0);
|
|
fclose(dst);
|
|
dst = NULL;
|
|
if (LLFile::rename(tmpfile, dstfile) == -1) goto err; /* Flawfinder: ignore */
|
|
retval = TRUE;
|
|
err:
|
|
if (src != NULL) gzclose(src);
|
|
if (dst != NULL) fclose(dst);
|
|
return retval;
|
|
}
|
|
|
|
BOOL gzip_file(const std::string& srcfile, const std::string& dstfile)
|
|
{
|
|
const S32 COMPRESS_BUFFER_SIZE = 32768;
|
|
std::string tmpfile;
|
|
BOOL retval = FALSE;
|
|
U8 buffer[COMPRESS_BUFFER_SIZE];
|
|
gzFile dst = NULL;
|
|
LLFILE *src = NULL;
|
|
S32 bytes = 0;
|
|
tmpfile = dstfile + ".t";
|
|
|
|
#ifdef LL_WINDOWS
|
|
llutf16string utf16filename = utf8str_to_utf16str(tmpfile);
|
|
dst = gzopen_w(utf16filename.c_str(), "wb");
|
|
#else
|
|
dst = gzopen(tmpfile.c_str(), "wb");
|
|
#endif
|
|
|
|
if (! dst) goto err;
|
|
src = LLFile::fopen(srcfile, "rb"); /* Flawfinder: ignore */
|
|
if (! src) goto err;
|
|
|
|
while ((bytes = (S32)fread(buffer, sizeof(U8), COMPRESS_BUFFER_SIZE, src)) > 0)
|
|
{
|
|
if (gzwrite(dst, buffer, bytes) <= 0)
|
|
{
|
|
LL_WARNS() << "gzwrite failed: " << gzerror(dst, NULL) << LL_ENDL;
|
|
goto err;
|
|
}
|
|
}
|
|
|
|
if (ferror(src))
|
|
{
|
|
LL_WARNS() << "Error reading " << srcfile << LL_ENDL;
|
|
goto err;
|
|
}
|
|
|
|
gzclose(dst);
|
|
dst = NULL;
|
|
#if LL_WINDOWS
|
|
// Rename in windows needs the dstfile to not exist.
|
|
LLFile::remove(dstfile);
|
|
#endif
|
|
if (LLFile::rename(tmpfile, dstfile) == -1) goto err; /* Flawfinder: ignore */
|
|
retval = TRUE;
|
|
err:
|
|
if (src != NULL) fclose(src);
|
|
if (dst != NULL) gzclose(dst);
|
|
return retval;
|
|
}
|
|
|
|
#if LL_DARWIN
|
|
// disable warnings about Gestalt calls being deprecated
|
|
// until Apple get's on the ball and provides an alternative
|
|
//
|
|
#pragma GCC diagnostic ignored "-Wdeprecated-declarations"
|
|
#endif
|